IC Chips

74 series Digital Integrated Circuits

CD40 series Digital Integrated Circuits

Optical Couplers

Clock & Calculator ICs

Operational Amplifiers

Power Switch Ics

Driver Ics

Flash Memory

Memory

Audio Special Purpose

Clock/Timing - Application Specific

Clock/Timing - Clock Buffers, Drivers

Clock/Timing - Clock Generators, PLLs, Frequency Synthesizers

Clock/Timing - Delay Lines

Clock/Timing - IC Batteries

Clock/Timing - Programmable Timers and Oscillators

Clock/Timing - Real Time Clocks

Data Acquisition - ADCs/DACs - Special Purpose

Data Acquisition - Analog Front End (AFE)

Data Acquisition - Analog to Digital Converters (ADC)

Data Acquisition - Digital Potentiometers

Data Acquisition - Digital to Analog Converters (DAC)

Data Acquisition - Touch Screen Controllers

Embedded - CPLDs (Complex Programmable Logic Devices)

Embedded - DSP (Digital Signal Processors)

Embedded - FPGAs (Field Programmable Gate Array)

Embedded - FPGAs (Field Programmable Gate Array) with Microcontrollers

Embedded - Microcontroller, Microprocessor, FPGA Modules

Embedded - Microcontrollers

Embedded - Microcontrollers - Application Specific

Embedded - Microprocessors

Embedded - PLDs (Programmable Logic Device)

Embedded - System On Chip (SoC)

Interface - Analog Switches - Special Purpose

Interface - Analog Switches, Multiplexers, Demultiplexers

Interface - CODECs

Interface - Controllers

Interface - Direct Digital Synthesis (DDS)

Interface - Drivers, Receivers, Transceivers

Interface - Encoders, Decoders, Converters

Interface - Filters - Active

Interface - I/O Expanders

Interface - Modems - ICs and Modules

Interface - Modules

Interface - Sensor and Detector Interfaces

Interface - Sensor, Capacitive Touch

Interface - Serializers, Deserializers

Interface - Signal Buffers, Repeaters, Splitters

Interface - Signal Terminators

Interface - Specialized

Interface - Telecom

Interface - UARTs (Universal Asynchronous Receiver Transmitter)

Interface - Voice Record and Playback

Linear - Amplifiers - Audio

Linear - Amplifiers - Instrumentation, OP Amps, Buffer Amps

Linear - Amplifiers - Special Purpose

Linear - Amplifiers - Video Amps and Modules

Linear - Analog Multipliers, Dividers

Linear - Comparators

Linear - Video Processing

Logic - Buffers, Drivers, Receivers, Transceivers

Logic - Comparators

Logic - Counters, Dividers

Logic - FIFOs Memory

Logic - Flip Flops

Logic - Gates and Inverters

Logic - Gates and Inverters - Multi-Function, Configurable

Logic - Latches

Logic - Multivibrators

Logic - Parity Generators and Checkers

Logic - Shift Registers

Logic - Signal Switches, Multiplexers, Decoders

Logic - Specialty Logic

Logic - Translators, Level Shifters

Logic - Universal Bus Functions

Memory - Batteries

Memory - Configuration Proms for FPGAs

Memory - Controllers

PMIC - AC DC Converters, Offline Switchers

PMIC - Battery Chargers

PMIC - Battery Management

PMIC - Current Regulation/Management

PMIC - Display Drivers

PMIC - Energy Metering

PMIC - Full, Half-Bridge Drivers

PMIC - Gate Drivers

PMIC - Hot Swap Controllers

PMIC - Laser Drivers

PMIC - LED Drivers

PMIC - Lighting, Ballast Controllers

PMIC - Motor Drivers, Controllers

PMIC - OR Controllers, Ideal Diodes

PMIC - PFC (Power Factor Correction)

PMIC - Power Distribution Switches, Load Drivers

PMIC - Power Management - Specialized

PMIC - Power Over Ethernet (PoE) Controllers

PMIC - Power Supply Controllers, Monitors

PMIC - RMS to DC Converters

PMIC - Supervisors

PMIC - Thermal Management

PMIC - V/F and F/V Converters

PMIC - Voltage Reference

PMIC - Voltage Regulators - DC DC Switching Controllers

PMIC - Voltage Regulators - DC DC Switching Regulators

PMIC - Voltage Regulators - Linear

PMIC - Voltage Regulators - Linear + Switching

PMIC - Voltage Regulators - Linear Regulator Controllers

PMIC - Voltage Regulators - Special Purpose

Specialized ICs

Modules

IGBT

IPM

Thyristors

Rectifiers

Power Supply

Smart Power Module

SCR,GTO and Diode

FET

Darlington Transistors

RF Modules

CNC PRODUCTS

ENCODER

Motor

Servo drive & amplifier & Servo

Diode Module

Transistor Module

Switch Relay

PLC

Inverter

Contactor & Breaker

Elevator Board

Industry Control

Transistors

Diode

Bipolar transistors

Resistors

Carbon Film Resistors

Cement Resistors

Chassis Mount Resistors

Chip Resistor - Surface Mount

Current Sense Resistors

Fusible Chip Resistor

High Precision & Low TCR SMD Resistors

High Voltage Resistor

LED Strip Resistors

MELF Resistor

Metal Alloy Resistors

Metal Film Resistor (TH)

Metal Glaze Resistors

Metal Oxide Film Resistors

Metal Oxide Resistors

NTC Thermistors

PTC Thermistors

Photoresistors

Potentiometers & Variable Resistors

Precision Potentiometer

Resistor Networks & Arrays

Resistor Networks & Arrays (TH)

Ultra Low Resistors (SMD)

Variable Resistors

Varistors

Wirewound Resistors

Capacitors

Aluminum Electrolytic Capacitors - SMD

CL21 Capacitor

Ceramic Disc Capacitors

High Voltage Capacitors

Metallized Polyester Film Capacitor

Multilayer Ceramic Capacitors MLCC - Leaded

Multilayer Ceramic Capacitors MLCC - SMD/SMT

Mylar Capacitor

Niobium Oxide Capacitors

Polyester Film Capacitors

Solid Polymer Electrolytic Capacitor

Supercapacitors & Ultracapacitors

Suppression Capacitors

Tantalum Capacitors

Trimmers, Variable Capacitors

Inductors & Ferrite Beads & Transformers

Antennas

Current Transformers

General Inductors (TH)

HF Inductors

Inductors (SMD)

LINE Filter

Power Inductors

Power Transformer

RJ45 Transformer

Radial Inductor (TH)

The circular inductors

Crystals

49S

49SMD

49U

Ceramic Resonators

DIP Oscillators(XO)

Radial Cylinder Crystals

SAW Resonators

SMD Crystals

SMD Oscillators(XO)

Connectors

AV Connectors

Audio & Video Connectors

Banana and Tip Connectors

Card Edge Connectors

Circular Connectors

Connector - Card Sockets

Connectors

Connectors - Accessories

Connectors - Housings

Contacts

D-Sub Connectors

Ethernet Connectors/Modular Connectors

FFC, FPC (Flat Flexible) Connectors

Fiber Optic Connectors

IC & Component Sockets

LED Light Pipes

Mezzanine Connectors (Board to Board)

PCB Connectors - Headers, Male Pins

PCB Connectors - Headers, Receptacles, Female Sockets

PCB Connectors - Housings

Power Connectors

RF Connectors/Coaxial Connectors

Shunts & Jumpers

Terminal Blocks - Accessories

Terminal Blocks - Barrier Blocks

Terminal Blocks - Din Rail, Channel

Terminal Blocks - Headers, Plugs and Sockets

Terminals

Test Clips

Test Points/Test Rings

USB Connectors

Unspecified Connectors

Screw-type wiring

Spring-type wiring

Pluggable Terminal Blocks

Through-wall Terminal Blocks

Sign In

3.Enter "account center"->"My inquiries" and check the status of your inquiries

Dear customers, due to the implementation of the GDPR policy in Europe, UTSOURCE has also made adjustment accordingly to meet the policy requirements. Please read the new privacy policy carefully and this window will no longer pop up after you accept it.

I agree all UTSOURCE Terms & Conditions,Privacy Statement
Agree Later Submit

Express:(FEDEX, UPS, DHL, TNT)Free shipping on first 0.5kg for orders over 150$,Overweight will be charged separately

. More details, pls click
relate product result :258 items
Filters:
clear
Current Rating (Max) :

Clear

Voltage Rating - DC :

Clear

Inductance @ Frequency :

Clear

DC Resistance (DCR) (Max) :

Clear

Withstanding Voltage :

Clear

Filter Type :

Clear

Impedance @ Frequency :

Clear

manufacturer :

Clear

Part Number

Product Description Encapsulation / Inductance / Tolerance / Current Rating

Description

Price / PLUS price

Sunltech Tech SMW3225S601HTE

≥1:

US $0.29744

US $0.26998

≥10:

US $0.22048

US $0.20013

≥30:

US $0.20631

US $0.18727

≥100:

US $0.19227

US $0.17452

≥500:

US $0.18603

US $0.16886

≥1000:

US $0.18291

US $0.16603

More: Inquiry

Stock:11733

Minimum:8

Sunltech Tech SMW4532B102HTE

≥1:

US $0.37765

US $0.34279

≥10:

US $0.28002

US $0.25417

≥30:

US $0.26208

US $0.23789

≥100:

US $0.24427

US $0.22172

≥500:

US $0.23621

US $0.21441

≥1000:

US $0.23231

US $0.21087

More: Inquiry

Stock:4125

Minimum:6

EMTEK CMF2012F-201M-2P-T(5pcs)

≥1:

US $0.45370

US $0.41182

≥10:

US $0.34320

US $0.31152

≥30:

US $0.32240

US $0.29264

≥100:

US $0.30225

US $0.27435

≥500:

US $0.29315

US $0.26609

≥1000:

US $0.28860

US $0.26196

More: Inquiry

Stock:1445

Minimum:5

EMTEK CMF2012F-221M-2P-T(5pcs)

≥1:

US $0.45370

US $0.41182

≥10:

US $0.34320

US $0.31152

≥30:

US $0.32240

US $0.29264

≥100:

US $0.30225

US $0.27435

≥500:

US $0.29315

US $0.26609

≥1000:

US $0.28860

US $0.26196

More: Inquiry

Stock:1970

Minimum:5

Murata Electronics DLW43SH510XK2L

≥1:

US $0.49621

US $0.45041

≥10:

US $0.36400

US $0.33040

≥30:

US $0.33800

US $0.30680

≥100:

US $0.31421

US $0.28521

≥500:

US $0.30329

US $0.27529

≥1000:

US $0.29679

US $0.26939

More: Inquiry

Stock:2613

Minimum:5

Chilisin Elec MCF21T-900M-N2(5pcs)

≥1:

US $0.50830

US $0.46138

≥10:

US $0.38415

US $0.34869

≥30:

US $0.36140

US $0.32804

≥100:

US $0.33865

US $0.30739

≥500:

US $0.32825

US $0.29795

≥1000:

US $0.32305

US $0.29323

More: Inquiry

Stock:2965

Minimum:5

Sunltech Tech SMW2012B900DTE(5pcs)

≥1:

US $0.55835

US $0.50681

≥10:

US $0.41860

US $0.37996

≥30:

US $0.39260

US $0.35636

≥100:

US $0.36660

US $0.33276

≥500:

US $0.35555

US $0.32273

≥1000:

US $0.34970

US $0.31742

More: Inquiry

Stock:4310

Minimum:4

EMTEK CMF2012H4-121-2P-T(5pcs)

≥1:

US $0.63570

US $0.57702

≥10:

US $0.48100

US $0.43660

≥30:

US $0.45240

US $0.41064

≥100:

US $0.42380

US $0.38468

≥500:

US $0.41145

US $0.37347

≥1000:

US $0.40495

US $0.36757

More: Inquiry

Stock:1740

Minimum:4

EMTEK CMF4532LC-510-2P-T

≥1:

US $0.69121

US $0.62741

≥10:

US $0.50921

US $0.46221

≥30:

US $0.47671

US $0.43271

≥100:

US $0.44200

US $0.40120

≥500:

US $0.42679

US $0.38739

≥1000:

US $0.42029

US $0.38149

More: Inquiry

Stock:47

Minimum:4

Sunltech Tech SMW3216B102ATE(5pcs)

≥1:

US $0.72085

US $0.65431

≥10:

US $0.53105

US $0.48203

≥30:

US $0.49660

US $0.45076

≥100:

US $0.46150

US $0.41890

≥500:

US $0.44655

US $0.40533

≥1000:

US $0.43875

US $0.39825

More: Inquiry

Stock:26325

Minimum:4

EMTEK CMF4532LC-101-2P-T

≥1:

US $0.70733

US $0.64204

≥10:

US $0.52949

US $0.48061

≥30:

US $0.49842

US $0.45241

≥100:

US $0.46540

US $0.42244

≥500:

US $0.45084

US $0.40922

≥1000:

US $0.44460

US $0.40356

More: Inquiry

Stock:446

Minimum:4

Sunltech Tech SMW2012B121DTE(10pcs)

≥1:

US $0.72540

US $0.65844

≥10:

US $0.53950

US $0.48970

≥30:

US $0.50440

US $0.45784

≥100:

US $0.47060

US $0.42716

≥500:

US $0.45500

US $0.41300

≥1000:

US $0.44850

US $0.40710

More: Inquiry

Stock:6770

Minimum:4

Sunltech Tech SMW5045S102LTT

≥1:

US $0.76479

US $0.69419

≥10:

US $0.56771

US $0.51531

≥30:

US $0.53079

US $0.48179

≥100:

US $0.49400

US $0.44840

≥500:

US $0.47879

US $0.43459

≥1000:

US $0.47021

US $0.42681

More: Inquiry

Stock:6285

Minimum:3

Sumida CPFC74NP-CB10M4

≥1:

US $0.80821

US $0.73361

≥10:

US $0.59579

US $0.54079

≥30:

US $0.55679

US $0.50539

≥100:

US $0.51779

US $0.46999

≥500:

US $0.50050

US $0.45430

≥1000:

US $0.49179

US $0.44639

More: Inquiry

Stock:4404

Minimum:3

Sunltech Tech SMW7060S701NTT

≥1:

US $0.82550

US $0.74930

≥10:

US $0.61100

US $0.55460

≥30:

US $0.56979

US $0.51719

≥100:

US $0.53079

US $0.48179

≥500:

US $0.51350

US $0.46610

≥1000:

US $0.50479

US $0.45819

More: Inquiry

Stock:2541

Minimum:3

EMTEK CMF2012H3-900-2P-TO(5pcs)

≥1:

US $0.81380

US $0.73868

≥10:

US $0.61555

US $0.55873

≥30:

US $0.57915

US $0.52569

≥100:

US $0.54275

US $0.49265

≥500:

US $0.52650

US $0.47790

≥1000:

US $0.51805

US $0.47023

More: Inquiry

Stock:1660

Minimum:3

Murata Electronics DLP11SN241HL2L(5pcs)

≥1:

US $0.83590

US $0.75874

≥10:

US $0.62920

US $0.57112

≥30:

US $0.59085

US $0.53631

≥100:

US $0.55315

US $0.50209

≥500:

US $0.53625

US $0.48675

≥1000:

US $0.52780

US $0.47908

More: Inquiry

Stock:1685

Minimum:3

Murata Electronics DLW31SH222SQ2L

≥1:

US $0.89271

US $0.81031

≥10:

US $0.65000

US $0.59000

≥30:

US $0.60671

US $0.55071

≥100:

US $0.56329

US $0.51129

≥500:

US $0.54379

US $0.49359

≥1000:

US $0.53300

US $0.48380

More: Inquiry

Stock:1972

Minimum:3

BC(Bao Cheng Elec) CYSCM4520FTL-142

≥1:

US $1.11579

US $1.01279

≥10:

US $0.83200

US $0.75520

≥30:

US $0.78000

US $0.70800

≥100:

US $0.72800

US $0.66080

≥500:

US $0.70421

US $0.63921

≥1000:

US $0.69329

US $0.62929

More: Inquiry

Stock:1285

Minimum:2

No matching goods? Inquiry here.
<<<1 2 3 4 5 6 7 8 9 10 11 12 13 >>>
Alternate Text

Currency:

Alternate Text Alternate Text Alternate Text

Product New Used

Stop production experts, we can provide a large number of electronic components that have been stopped production and are difficult to find, to facilitate the maintenance company

Alternate Text Stock

Non-Stock

Non-Stock

GLOBAL PAYMENTS

Global logistics

footShip
Copyright © 2020 Power by UTSOURCE HOLDING COMPANY LIMITED ISO/IEC 20000-1:2011,ISO/IEC 27001:2013